C16H16N2O4 — CID 9385406
[2-(N-methylanilino)-2-oxoethyl] 4-acetyl-1H-pyrrole-2-carboxylate (PubChem CID 9385406) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is [2-(N-methylanilino)-2-oxoethyl] 4-acetyl-1H-pyrrole-2-carboxylate.
| Compound Name | [2-(N-methylanilino)-2-oxoethyl] 4-acetyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 9385406 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | [2-(N-methylanilino)-2-oxoethyl] 4-acetyl-1H-pyrrole-2-carboxylate |
| SMILES | CC(=O)c1c[nH]c(C(=O)OCC(=O)N(C)c2ccccc2)c1 |
| InChI | InChI=1S/C16H16N2O4/c1-11(19)12-8-14(17-9-12)16(21)22-10-15(20)18(2)13-6-4-3-5-7-13/h3-9,17H,10H2,1-2H3 |
| InChIKey | ODBQJOYZGCUFMN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |