About [2-(N-methylanilino)-2-oxoethyl] 3-methylbenzoate
[2-(N-methylanilino)-2-oxoethyl] 3-methylbenzoate (PubChem CID 46860545) has the molecular formula C17H17NO3
and a molecular weight of 283.33 g/mol. Its IUPAC name is [2-(N-methylanilino)-2-oxoethyl] 3-methylbenzoate.
Molecular Properties
| Compound Name | [2-(N-methylanilino)-2-oxoethyl] 3-methylbenzoate |
| PubChem CID | 46860545 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | [2-(N-methylanilino)-2-oxoethyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCC(=O)N(C)c2ccccc2)c1 |
| InChI | InChI=1S/C17H17NO3/c1-13-7-6-8-14(11-13)17(20)21-12-16(19)18(2)15-9-4-3-5-10-15/h3-11H,12H2,1-2H3 |
| InChIKey | SUONTBSQMOAEOG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(N-methylanilino)-2-oxoethyl] 3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(N-methylanilino)-2-oxoethyl] 3-methylbenzoate?
The IUPAC name of [2-(N-methylanilino)-2-oxoethyl] 3-methylbenzoate (CID 46860545) is [2-(N-methylanilino)-2-oxoethyl] 3-methylbenzoate.
What is the SMILES notation for [2-(N-methylanilino)-2-oxoethyl] 3-methylbenzoate?
The canonical SMILES for [2-(N-methylanilino)-2-oxoethyl] 3-methylbenzoate is Cc1cccc(C(=O)OCC(=O)N(C)c2ccccc2)c1.
What is the InChIKey of [2-(N-methylanilino)-2-oxoethyl] 3-methylbenzoate?
The InChIKey is SUONTBSQMOAEOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO3/c1-13-7-6-8-14(11-13)17(20)21-12-16(19)18(2)15-9-4-3-5-10-15/h3-11H,12H2,1-2H3.
What are the key properties of [2-(N-methylanilino)-2-oxoethyl] 3-methylbenzoate?
[2-(N-methylanilino)-2-oxoethyl] 3-methylbenzoate has a molecular weight of 283.33 g/mol, XLogP of 2.81, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(N-methylanilino)-2-oxoethyl] 3-methylbenzoate is sourced from PubChem (CID 46860545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).