C15H15ClN2O — CID 9391192
3-chloro-N-[(Z)-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]aniline (PubChem CID 9391192) has the molecular formula C15H15ClN2O and a molecular weight of 274.75 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]aniline.
| Compound Name | 3-chloro-N-[(Z)-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 9391192 |
| Molecular Formula | C15H15ClN2O |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 3-chloro-N-[(Z)-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]aniline |
| SMILES | C[C@@H]1C[C@@H]1c1ccc(/C=N\Nc2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C15H15ClN2O/c1-10-7-14(10)15-6-5-13(19-15)9-17-18-12-4-2-3-11(16)8-12/h2-6,8-10,14,18H,7H2,1H3/b17-9-/t10-,14+/m1/s1 |
| InChIKey | ALNZVLSSLVOVBO-KOJHPZCCSA-N |
| XLogP | 4.50 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|