C21H22N4O3 — CID 9394597
N-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-4-oxo-3-propan-2-ylphthalazine-1-carboxamide (PubChem CID 9394597) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-4-oxo-3-propan-2-ylphthalazine-1-carboxamide.
| Compound Name | N-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-4-oxo-3-propan-2-ylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9394597 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-4-oxo-3-propan-2-ylphthalazine-1-carboxamide |
| SMILES | CC(C)n1nc(C(=O)N/N=C\c2ccc([C@@H]3C[C@H]3C)o2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H22N4O3/c1-12(2)25-21(27)16-7-5-4-6-15(16)19(24-25)20(26)23-22-11-14-8-9-18(28-14)17-10-13(17)3/h4-9,11-13,17H,10H2,1-3H3,(H,23,26)/b22-11-/t13-,17-/m1/s1 |
| InChIKey | FQFYDWNEADZKKU-WUIZIMAHSA-N |
| XLogP | 3.46 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|