C17H22N4O2S — CID 9395546
(2S)-N-[(Z)-1-(5-amino-3-methyl-1,2-thiazol-4-yl)ethylideneamino]-2-(2,3-dimethylphenoxy)propanamide (PubChem CID 9395546) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is (2S)-N-[(Z)-1-(5-amino-3-methyl-1,2-thiazol-4-yl)ethylideneamino]-2-(2,3-dimethylphenoxy)propanamide.
| Compound Name | (2S)-N-[(Z)-1-(5-amino-3-methyl-1,2-thiazol-4-yl)ethylideneamino]-2-(2,3-dimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 9395546 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (2S)-N-[(Z)-1-(5-amino-3-methyl-1,2-thiazol-4-yl)ethylideneamino]-2-(2,3-dimethylphenoxy)propanamide |
| SMILES | C/C(=N/NC(=O)[C@H](C)Oc1cccc(C)c1C)c1c(C)nsc1N |
| InChI | InChI=1S/C17H22N4O2S/c1-9-7-6-8-14(10(9)2)23-13(5)17(22)20-19-11(3)15-12(4)21-24-16(15)18/h6-8,13H,18H2,1-5H3,(H,20,22)/b19-11-/t13-/m0/s1 |
| InChIKey | GQXAZSJGOCUAPC-JFENUBAZSA-N |
| XLogP | 2.96 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|