C13H13Cl2N5O — CID 94001278
(1R)-2,2-dichloro-1-methyl-N-[2-methyl-5-(tetrazol-1-yl)phenyl]cyclopropane-1-carboxamide (PubChem CID 94001278) has the molecular formula C13H13Cl2N5O and a molecular weight of 326.19 g/mol. Its IUPAC name is (1R)-2,2-dichloro-1-methyl-N-[2-methyl-5-(tetrazol-1-yl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-dichloro-1-methyl-N-[2-methyl-5-(tetrazol-1-yl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 94001278 |
| Molecular Formula | C13H13Cl2N5O |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | (1R)-2,2-dichloro-1-methyl-N-[2-methyl-5-(tetrazol-1-yl)phenyl]cyclopropane-1-carboxamide |
| SMILES | Cc1ccc(-n2cnnn2)cc1NC(=O)[C@@]1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C13H13Cl2N5O/c1-8-3-4-9(20-7-16-18-19-20)5-10(8)17-11(21)12(2)6-13(12,14)15/h3-5,7H,6H2,1-2H3,(H,17,21)/t12-/m1/s1 |
| InChIKey | PAFXOTSNYLKXOE-GFCCVEGCSA-N |
| XLogP | 2.49 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|