C28H26FNO3 — CID 94016431
(2R)-N-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-naphthalen-1-yloxybutanamide (PubChem CID 94016431) has the molecular formula C28H26FNO3 and a molecular weight of 443.52 g/mol. Its IUPAC name is (2R)-N-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-naphthalen-1-yloxybutanamide.
| Compound Name | (2R)-N-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-naphthalen-1-yloxybutanamide |
|---|---|
| PubChem CID | 94016431 |
| Molecular Formula | C28H26FNO3 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | (2R)-N-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-naphthalen-1-yloxybutanamide |
| SMILES | CC[C@@H](Oc1cccc2ccccc12)C(=O)NCc1ccc(OCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H26FNO3/c1-2-26(33-27-9-5-7-22-6-3-4-8-25(22)27)28(31)30-18-20-12-16-24(17-13-20)32-19-21-10-14-23(29)15-11-21/h3-17,26H,2,18-19H2,1H3,(H,30,31)/t26-/m1/s1 |
| InChIKey | RHPFMCKNRBJZBD-AREMUKBSSA-N |
| XLogP | 6.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |