C16H17N3O3 — CID 940167
6-hydroxy-1-prop-2-enyl-5-[(1S)-1,2,3,4-tetrahydroisoquinolin-1-yl]pyrimidine-2,4-dione (PubChem CID 940167) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 6-hydroxy-1-prop-2-enyl-5-[(1S)-1,2,3,4-tetrahydroisoquinolin-1-yl]pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1-prop-2-enyl-5-[(1S)-1,2,3,4-tetrahydroisoquinolin-1-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 940167 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 6-hydroxy-1-prop-2-enyl-5-[(1S)-1,2,3,4-tetrahydroisoquinolin-1-yl]pyrimidine-2,4-dione |
| SMILES | C=CCn1c(O)c([C@H]2NCCc3ccccc32)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H17N3O3/c1-2-9-19-15(21)12(14(20)18-16(19)22)13-11-6-4-3-5-10(11)7-8-17-13/h2-6,13,17,21H,1,7-9H2,(H,18,20,22)/t13-/m0/s1 |
| InChIKey | GGQYIXWPAHDGCK-ZDUSSCGKSA-N |
| XLogP | 0.66 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|