C17H17N3O3 — CID 94029882
3-(2-oxo-1,3-oxazolidin-3-yl)-N-[(1R)-1-pyridin-4-ylethyl]benzamide (PubChem CID 94029882) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 3-(2-oxo-1,3-oxazolidin-3-yl)-N-[(1R)-1-pyridin-4-ylethyl]benzamide.
| Compound Name | 3-(2-oxo-1,3-oxazolidin-3-yl)-N-[(1R)-1-pyridin-4-ylethyl]benzamide |
|---|---|
| PubChem CID | 94029882 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-(2-oxo-1,3-oxazolidin-3-yl)-N-[(1R)-1-pyridin-4-ylethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1cccc(N2CCOC2=O)c1)c1ccncc1 |
| InChI | InChI=1S/C17H17N3O3/c1-12(13-5-7-18-8-6-13)19-16(21)14-3-2-4-15(11-14)20-9-10-23-17(20)22/h2-8,11-12H,9-10H2,1H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | GEDRXFPCUUOPHW-GFCCVEGCSA-N |
| XLogP | 2.53 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |