C12H19NO2 — CID 94036929
methyl N-[(4R,7S)-1-tricyclo[5.2.1.04,10]decanyl]carbamate (PubChem CID 94036929) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is methyl N-[(4R,7S)-1-tricyclo[5.2.1.04,10]decanyl]carbamate.
| Compound Name | methyl N-[(4R,7S)-1-tricyclo[5.2.1.04,10]decanyl]carbamate |
|---|---|
| PubChem CID | 94036929 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | methyl N-[(4R,7S)-1-tricyclo[5.2.1.04,10]decanyl]carbamate |
| SMILES | COC(=O)NC12CC[C@H]3CC[C@@H](CC1)C32 |
| InChI | InChI=1S/C12H19NO2/c1-15-11(14)13-12-6-4-8-2-3-9(5-7-12)10(8)12/h8-10H,2-7H2,1H3,(H,13,14)/t8-,9+,10?,12? |
| InChIKey | XRKQDMZKLRBVKI-GJYTXDDASA-N |
| XLogP | 2.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |