C16H19ClO2 — CID 94037400
(1R,8S)-11-chloro-3,6-dimethoxy-11-prop-1-en-2-yltricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 94037400) has the molecular formula C16H19ClO2 and a molecular weight of 278.78 g/mol. Its IUPAC name is (1R,8S)-11-chloro-3,6-dimethoxy-11-prop-1-en-2-yltricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1R,8S)-11-chloro-3,6-dimethoxy-11-prop-1-en-2-yltricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 94037400 |
| Molecular Formula | C16H19ClO2 |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (1R,8S)-11-chloro-3,6-dimethoxy-11-prop-1-en-2-yltricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | C=C(C)C1(Cl)[C@@H]2CC[C@H]1c1c(OC)ccc(OC)c12 |
| InChI | InChI=1S/C16H19ClO2/c1-9(2)16(17)10-5-6-11(16)15-13(19-4)8-7-12(18-3)14(10)15/h7-8,10-11H,1,5-6H2,2-4H3/t10-,11+,16? |
| InChIKey | LOOCZHGLXBNUMM-SOSAQKQKSA-N |
| XLogP | 4.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|