C22H23N3O3 — CID 94070043
[(2R)-oxolan-2-yl]methyl 3-(2,4-dimethylanilino)quinoxaline-2-carboxylate (PubChem CID 94070043) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl 3-(2,4-dimethylanilino)quinoxaline-2-carboxylate.
| Compound Name | [(2R)-oxolan-2-yl]methyl 3-(2,4-dimethylanilino)quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 94070043 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl 3-(2,4-dimethylanilino)quinoxaline-2-carboxylate |
| SMILES | Cc1ccc(Nc2nc3ccccc3nc2C(=O)OC[C@H]2CCCO2)c(C)c1 |
| InChI | InChI=1S/C22H23N3O3/c1-14-9-10-17(15(2)12-14)24-21-20(22(26)28-13-16-6-5-11-27-16)23-18-7-3-4-8-19(18)25-21/h3-4,7-10,12,16H,5-6,11,13H2,1-2H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | GTVFWCAELTWUKC-MRXNPFEDSA-N |
| XLogP | 4.33 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |