About oxolan-2-ylmethyl 3-(3,4-dimethylanilino)quinoxaline-2-carboxylate
oxolan-2-ylmethyl 3-(3,4-dimethylanilino)quinoxaline-2-carboxylate (PubChem CID 50820793) has the molecular formula C22H23N3O3
and a molecular weight of 377.44 g/mol. Its IUPAC name is oxolan-2-ylmethyl 3-(3,4-dimethylanilino)quinoxaline-2-carboxylate.
Molecular Properties
| Compound Name | oxolan-2-ylmethyl 3-(3,4-dimethylanilino)quinoxaline-2-carboxylate |
| PubChem CID | 50820793 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | oxolan-2-ylmethyl 3-(3,4-dimethylanilino)quinoxaline-2-carboxylate |
| SMILES | Cc1ccc(Nc2nc3ccccc3nc2C(=O)OCC2CCCO2)cc1C |
| InChI | InChI=1S/C22H23N3O3/c1-14-9-10-16(12-15(14)2)23-21-20(22(26)28-13-17-6-5-11-27-17)24-18-7-3-4-8-19(18)25-21/h3-4,7-10,12,17H,5-6,11,13H2,1-2H3,(H,23,25) |
| InChIKey | MPMONFSXFFXLDH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze oxolan-2-ylmethyl 3-(3,4-dimethylanilino)quinoxaline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-2-ylmethyl 3-(3,4-dimethylanilino)quinoxaline-2-carboxylate?
The IUPAC name of oxolan-2-ylmethyl 3-(3,4-dimethylanilino)quinoxaline-2-carboxylate (CID 50820793) is oxolan-2-ylmethyl 3-(3,4-dimethylanilino)quinoxaline-2-carboxylate.
What is the SMILES notation for oxolan-2-ylmethyl 3-(3,4-dimethylanilino)quinoxaline-2-carboxylate?
The canonical SMILES for oxolan-2-ylmethyl 3-(3,4-dimethylanilino)quinoxaline-2-carboxylate is Cc1ccc(Nc2nc3ccccc3nc2C(=O)OCC2CCCO2)cc1C.
What is the InChIKey of oxolan-2-ylmethyl 3-(3,4-dimethylanilino)quinoxaline-2-carboxylate?
The InChIKey is MPMONFSXFFXLDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O3/c1-14-9-10-16(12-15(14)2)23-21-20(22(26)28-13-17-6-5-11-27-17)24-18-7-3-4-8-19(18)25-21/h3-4,7-10,12,17H,5-6,11,13H2,1-2H3,(H,23,25).
What are the key properties of oxolan-2-ylmethyl 3-(3,4-dimethylanilino)quinoxaline-2-carboxylate?
oxolan-2-ylmethyl 3-(3,4-dimethylanilino)quinoxaline-2-carboxylate has a molecular weight of 377.44 g/mol, XLogP of 4.33, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-2-ylmethyl 3-(3,4-dimethylanilino)quinoxaline-2-carboxylate is sourced from PubChem (CID 50820793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).