C8H12N2S — CID 94077040
6-ethyl-2,5-dimethyl-1H-pyrimidine-4-thione (PubChem CID 94077040) has the molecular formula C8H12N2S and a molecular weight of 168.26 g/mol. Its IUPAC name is 6-ethyl-2,5-dimethyl-1H-pyrimidine-4-thione.
| Compound Name | 6-ethyl-2,5-dimethyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 94077040 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 6-ethyl-2,5-dimethyl-1H-pyrimidine-4-thione |
| SMILES | CCc1[nH]c(C)nc(=S)c1C |
| InChI | InChI=1S/C8H12N2S/c1-4-7-5(2)8(11)10-6(3)9-7/h4H2,1-3H3,(H,9,10,11) |
| InChIKey | REFDUSNKVBWNAU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|