C9H14N2S — CID 94077051
2,6-diethyl-5-methyl-1H-pyrimidine-4-thione (PubChem CID 94077051) has the molecular formula C9H14N2S and a molecular weight of 182.29 g/mol. Its IUPAC name is 2,6-diethyl-5-methyl-1H-pyrimidine-4-thione.
| Compound Name | 2,6-diethyl-5-methyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 94077051 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2,6-diethyl-5-methyl-1H-pyrimidine-4-thione |
| SMILES | CCc1nc(=S)c(C)c(CC)[nH]1 |
| InChI | InChI=1S/C9H14N2S/c1-4-7-6(3)9(12)11-8(5-2)10-7/h4-5H2,1-3H3,(H,10,11,12) |
| InChIKey | XIQSBQGLCPGHIF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|