C12H17NOS — CID 94082032
(E)-N,2-dimethyl-N-(thiophen-3-ylmethyl)pent-2-enamide (PubChem CID 94082032) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is (E)-N,2-dimethyl-N-(thiophen-3-ylmethyl)pent-2-enamide.
| Compound Name | (E)-N,2-dimethyl-N-(thiophen-3-ylmethyl)pent-2-enamide |
|---|---|
| PubChem CID | 94082032 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (E)-N,2-dimethyl-N-(thiophen-3-ylmethyl)pent-2-enamide |
| SMILES | CC/C=C(\C)C(=O)N(C)Cc1ccsc1 |
| InChI | InChI=1S/C12H17NOS/c1-4-5-10(2)12(14)13(3)8-11-6-7-15-9-11/h5-7,9H,4,8H2,1-3H3/b10-5+ |
| InChIKey | LNYFZWSDTHTIFY-BJMVGYQFSA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|