C20H17NO4 — CID 940897
8-methoxy-1-(4-methoxyphenyl)-3-methyl-2-oxido-[1]benzofuro[3,2-c]pyridin-2-ium (PubChem CID 940897) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is 8-methoxy-1-(4-methoxyphenyl)-3-methyl-2-oxido-[1]benzofuro[3,2-c]pyridin-2-ium.
| Compound Name | 8-methoxy-1-(4-methoxyphenyl)-3-methyl-2-oxido-[1]benzofuro[3,2-c]pyridin-2-ium |
|---|---|
| PubChem CID | 940897 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 8-methoxy-1-(4-methoxyphenyl)-3-methyl-2-oxido-[1]benzofuro[3,2-c]pyridin-2-ium |
| SMILES | COc1ccc(-c2c3c(cc(C)[n+]2[O-])oc2ccc(OC)cc23)cc1 |
| InChI | InChI=1S/C20H17NO4/c1-12-10-18-19(16-11-15(24-3)8-9-17(16)25-18)20(21(12)22)13-4-6-14(23-2)7-5-13/h4-11H,1-3H3 |
| InChIKey | DIPRAFIKGBYDDD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 58.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|