C19H29N3O3S — CID 9409068
(3S)-N-[(Z)-2-methylpentan-3-ylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 9409068) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is (3S)-N-[(Z)-2-methylpentan-3-ylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[(Z)-2-methylpentan-3-ylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 9409068 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (3S)-N-[(Z)-2-methylpentan-3-ylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | CC/C(=N/NC(=O)[C@H]1CCCN(S(=O)(=O)c2ccc(C)cc2)C1)C(C)C |
| InChI | InChI=1S/C19H29N3O3S/c1-5-18(14(2)3)20-21-19(23)16-7-6-12-22(13-16)26(24,25)17-10-8-15(4)9-11-17/h8-11,14,16H,5-7,12-13H2,1-4H3,(H,21,23)/b20-18-/t16-/m0/s1 |
| InChIKey | RGDCFEBPYBQXGQ-MXLIYFDZSA-N |
| XLogP | 2.93 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|