C16H21F2N3O3S — CID 9410306
1-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 9410306) has the molecular formula C16H21F2N3O3S and a molecular weight of 373.43 g/mol. Its IUPAC name is 1-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 9410306 |
| Molecular Formula | C16H21F2N3O3S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | CCOc1cccc(/C=N\NC(=S)NC[C@@H]2CCCO2)c1OC(F)F |
| InChI | InChI=1S/C16H21F2N3O3S/c1-2-22-13-7-3-5-11(14(13)24-15(17)18)9-20-21-16(25)19-10-12-6-4-8-23-12/h3,5,7,9,12,15H,2,4,6,8,10H2,1H3,(H2,19,21,25)/b20-9-/t12-/m0/s1 |
| InChIKey | MQFMELMALRBROM-CATAHAEOSA-N |
| XLogP | 2.66 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|