C19H16F2N4O — CID 94104778
(Z)-3-(2,6-difluorophenyl)-N-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]prop-2-enamide (PubChem CID 94104778) has the molecular formula C19H16F2N4O and a molecular weight of 354.36 g/mol. Its IUPAC name is (Z)-3-(2,6-difluorophenyl)-N-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (Z)-3-(2,6-difluorophenyl)-N-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 94104778 |
| Molecular Formula | C19H16F2N4O |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (Z)-3-(2,6-difluorophenyl)-N-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C\c1c(F)cccc1F)NCc1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C19H16F2N4O/c20-17-2-1-3-18(21)16(17)8-9-19(26)23-10-14-4-6-15(7-5-14)11-25-13-22-12-24-25/h1-9,12-13H,10-11H2,(H,23,26)/b9-8- |
| InChIKey | JAUUXTUYJAWOAH-HJWRWDBZSA-N |
| XLogP | 2.93 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|