C21H27N3O3 — CID 94112463
ethyl N-[(3R)-1-(2-naphthalen-1-ylethylcarbamoyl)piperidin-3-yl]carbamate (PubChem CID 94112463) has the molecular formula C21H27N3O3 and a molecular weight of 369.46 g/mol. Its IUPAC name is ethyl N-[(3R)-1-(2-naphthalen-1-ylethylcarbamoyl)piperidin-3-yl]carbamate.
| Compound Name | ethyl N-[(3R)-1-(2-naphthalen-1-ylethylcarbamoyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 94112463 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | ethyl N-[(3R)-1-(2-naphthalen-1-ylethylcarbamoyl)piperidin-3-yl]carbamate |
| SMILES | CCOC(=O)N[C@@H]1CCCN(C(=O)NCCc2cccc3ccccc23)C1 |
| InChI | InChI=1S/C21H27N3O3/c1-2-27-21(26)23-18-10-6-14-24(15-18)20(25)22-13-12-17-9-5-8-16-7-3-4-11-19(16)17/h3-5,7-9,11,18H,2,6,10,12-15H2,1H3,(H,22,25)(H,23,26)/t18-/m1/s1 |
| InChIKey | ZRFYXABNEKHJSA-GOSISDBHSA-N |
| XLogP | 3.30 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |