C13H12BrN3O3S — CID 9414471
2-bromo-N-(pyridin-2-ylmethyl)-5-sulfamoylbenzamide (PubChem CID 9414471) has the molecular formula C13H12BrN3O3S and a molecular weight of 370.23 g/mol. Its IUPAC name is 2-bromo-N-(pyridin-2-ylmethyl)-5-sulfamoylbenzamide.
| Compound Name | 2-bromo-N-(pyridin-2-ylmethyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 9414471 |
| Molecular Formula | C13H12BrN3O3S |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 2-bromo-N-(pyridin-2-ylmethyl)-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(Br)c(C(=O)NCc2ccccn2)c1 |
| InChI | InChI=1S/C13H12BrN3O3S/c14-12-5-4-10(21(15,19)20)7-11(12)13(18)17-8-9-3-1-2-6-16-9/h1-7H,8H2,(H,17,18)(H2,15,19,20) |
| InChIKey | CMAZBIRWDNIOQU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |