C15H17BrN4O3S — CID 55692623
2-bromo-N-[[2-(dimethylamino)-3-pyridinyl]methyl]-5-sulfamoylbenzamide (PubChem CID 55692623) has the molecular formula C15H17BrN4O3S and a molecular weight of 413.30 g/mol. Its IUPAC name is 2-bromo-N-[[2-(dimethylamino)-3-pyridinyl]methyl]-5-sulfamoylbenzamide.
| Compound Name | 2-bromo-N-[[2-(dimethylamino)-3-pyridinyl]methyl]-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 55692623 |
| Molecular Formula | C15H17BrN4O3S |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 2-bromo-N-[[2-(dimethylamino)-3-pyridinyl]methyl]-5-sulfamoylbenzamide |
| SMILES | CN(C)c1ncccc1CNC(=O)c1cc(S(N)(=O)=O)ccc1Br |
| InChI | InChI=1S/C15H17BrN4O3S/c1-20(2)14-10(4-3-7-18-14)9-19-15(21)12-8-11(24(17,22)23)5-6-13(12)16/h3-8H,9H2,1-2H3,(H,19,21)(H2,17,22,23) |
| InChIKey | WNJAMSZVOKOQQW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |