C13H22N4O2 — CID 94159983
(2R)-1-morpholin-4-yl-2-[[(2R)-1-pyrazol-1-ylpropan-2-yl]amino]propan-1-one (PubChem CID 94159983) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is (2R)-1-morpholin-4-yl-2-[[(2R)-1-pyrazol-1-ylpropan-2-yl]amino]propan-1-one.
| Compound Name | (2R)-1-morpholin-4-yl-2-[[(2R)-1-pyrazol-1-ylpropan-2-yl]amino]propan-1-one |
|---|---|
| PubChem CID | 94159983 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (2R)-1-morpholin-4-yl-2-[[(2R)-1-pyrazol-1-ylpropan-2-yl]amino]propan-1-one |
| SMILES | C[C@H](Cn1cccn1)N[C@H](C)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H22N4O2/c1-11(10-17-5-3-4-14-17)15-12(2)13(18)16-6-8-19-9-7-16/h3-5,11-12,15H,6-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | RWRDUVJIDOEWJO-VXGBXAGGSA-N |
| XLogP | 0.11 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |