C15H27N5O2 — CID 95134950
1-(2-methyl-2-morpholin-4-ylpropyl)-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea (PubChem CID 95134950) has the molecular formula C15H27N5O2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-(2-methyl-2-morpholin-4-ylpropyl)-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea.
| Compound Name | 1-(2-methyl-2-morpholin-4-ylpropyl)-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea |
|---|---|
| PubChem CID | 95134950 |
| Molecular Formula | C15H27N5O2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 1-(2-methyl-2-morpholin-4-ylpropyl)-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea |
| SMILES | C[C@H](Cn1cccn1)NC(=O)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C15H27N5O2/c1-13(11-20-6-4-5-17-20)18-14(21)16-12-15(2,3)19-7-9-22-10-8-19/h4-6,13H,7-12H2,1-3H3,(H2,16,18,21)/t13-/m1/s1 |
| InChIKey | SQPJBRKZCUWNDS-CYBMUJFWSA-N |
| XLogP | 0.68 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |