C15H16BrN3O4S — CID 9418407
5-bromo-N-[2-[2-(5-ethyl-4-methylthiophene-2-carbonyl)hydrazinyl]-2-oxoethyl]furan-2-carboxamide (PubChem CID 9418407) has the molecular formula C15H16BrN3O4S and a molecular weight of 414.28 g/mol. Its IUPAC name is 5-bromo-N-[2-[2-(5-ethyl-4-methylthiophene-2-carbonyl)hydrazinyl]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[2-(5-ethyl-4-methylthiophene-2-carbonyl)hydrazinyl]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 9418407 |
| Molecular Formula | C15H16BrN3O4S |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | 5-bromo-N-[2-[2-(5-ethyl-4-methylthiophene-2-carbonyl)hydrazinyl]-2-oxoethyl]furan-2-carboxamide |
| SMILES | CCc1sc(C(=O)NNC(=O)CNC(=O)c2ccc(Br)o2)cc1C |
| InChI | InChI=1S/C15H16BrN3O4S/c1-3-10-8(2)6-11(24-10)15(22)19-18-13(20)7-17-14(21)9-4-5-12(16)23-9/h4-6H,3,7H2,1-2H3,(H,17,21)(H,18,20)(H,19,22) |
| InChIKey | SRYLVEDIYYJGPR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|