C16H22N2O5S — CID 94190804
(2R)-2-acetamido-2-cyclopentyl-N-(4-methoxyphenyl)sulfonylacetamide (PubChem CID 94190804) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is (2R)-2-acetamido-2-cyclopentyl-N-(4-methoxyphenyl)sulfonylacetamide.
| Compound Name | (2R)-2-acetamido-2-cyclopentyl-N-(4-methoxyphenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 94190804 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (2R)-2-acetamido-2-cyclopentyl-N-(4-methoxyphenyl)sulfonylacetamide |
| SMILES | COc1ccc(S(=O)(=O)NC(=O)[C@H](NC(C)=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C16H22N2O5S/c1-11(19)17-15(12-5-3-4-6-12)16(20)18-24(21,22)14-9-7-13(23-2)8-10-14/h7-10,12,15H,3-6H2,1-2H3,(H,17,19)(H,18,20)/t15-/m1/s1 |
| InChIKey | DPAACEWQLTVLQF-OAHLLOKOSA-N |
| XLogP | 1.20 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |