C18H27N5O2S — CID 9419278
N-(3-methylbutyl)-2-[(5S)-4-oxo-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1,3-thiazol-5-yl]acetamide (PubChem CID 9419278) has the molecular formula C18H27N5O2S and a molecular weight of 377.51 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-[(5S)-4-oxo-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1,3-thiazol-5-yl]acetamide.
| Compound Name | N-(3-methylbutyl)-2-[(5S)-4-oxo-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1,3-thiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 9419278 |
| Molecular Formula | C18H27N5O2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-(3-methylbutyl)-2-[(5S)-4-oxo-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1,3-thiazol-5-yl]acetamide |
| SMILES | CC(C)CCNC(=O)C[C@@H]1SC(Cc2nnc3n2CCCCC3)=NC1=O |
| InChI | InChI=1S/C18H27N5O2S/c1-12(2)7-8-19-16(24)10-13-18(25)20-17(26-13)11-15-22-21-14-6-4-3-5-9-23(14)15/h12-13H,3-11H2,1-2H3,(H,19,24)/t13-/m0/s1 |
| InChIKey | LXLWGNORIFMUAA-ZDUSSCGKSA-N |
| XLogP | 2.14 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |