C19H25ClN4O — CID 94195068
1-[(2S)-2-[(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylamino]propyl]pyrrolidin-2-one (PubChem CID 94195068) has the molecular formula C19H25ClN4O and a molecular weight of 360.89 g/mol. Its IUPAC name is 1-[(2S)-2-[(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylamino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[(2S)-2-[(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylamino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 94195068 |
| Molecular Formula | C19H25ClN4O |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-[(2S)-2-[(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylamino]propyl]pyrrolidin-2-one |
| SMILES | Cc1nn(Cc2ccccc2)c(Cl)c1CN[C@@H](C)CN1CCCC1=O |
| InChI | InChI=1S/C19H25ClN4O/c1-14(12-23-10-6-9-18(23)25)21-11-17-15(2)22-24(19(17)20)13-16-7-4-3-5-8-16/h3-5,7-8,14,21H,6,9-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | ZAAHGINWYNKFDB-AWEZNQCLSA-N |
| XLogP | 2.99 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |