C15H20N6O2 — CID 94197438
N-[(2R)-butan-2-yl]-4-[[[2-(tetrazol-1-yl)acetyl]amino]methyl]benzamide (PubChem CID 94197438) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-4-[[[2-(tetrazol-1-yl)acetyl]amino]methyl]benzamide.
| Compound Name | N-[(2R)-butan-2-yl]-4-[[[2-(tetrazol-1-yl)acetyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 94197438 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-[(2R)-butan-2-yl]-4-[[[2-(tetrazol-1-yl)acetyl]amino]methyl]benzamide |
| SMILES | CC[C@@H](C)NC(=O)c1ccc(CNC(=O)Cn2cnnn2)cc1 |
| InChI | InChI=1S/C15H20N6O2/c1-3-11(2)18-15(23)13-6-4-12(5-7-13)8-16-14(22)9-21-10-17-19-20-21/h4-7,10-11H,3,8-9H2,1-2H3,(H,16,22)(H,18,23)/t11-/m1/s1 |
| InChIKey | MAOFFJHDAWTGQU-LLVKDONJSA-N |
| XLogP | 0.52 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |