C14H22N4O2 — CID 94201395
1-(2-cyclopentylpyrazol-3-yl)-3-[[(2R)-oxolan-2-yl]methyl]urea (PubChem CID 94201395) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-(2-cyclopentylpyrazol-3-yl)-3-[[(2R)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-(2-cyclopentylpyrazol-3-yl)-3-[[(2R)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 94201395 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-(2-cyclopentylpyrazol-3-yl)-3-[[(2R)-oxolan-2-yl]methyl]urea |
| SMILES | O=C(NC[C@H]1CCCO1)Nc1ccnn1C1CCCC1 |
| InChI | InChI=1S/C14H22N4O2/c19-14(15-10-12-6-3-9-20-12)17-13-7-8-16-18(13)11-4-1-2-5-11/h7-8,11-12H,1-6,9-10H2,(H2,15,17,19)/t12-/m1/s1 |
| InChIKey | UKDYVICRAOQCRX-GFCCVEGCSA-N |
| XLogP | 2.30 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |