C18H17N5O — CID 942205
(4,6-dimethylpyrimidin-2-yl)-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]cyanamide (PubChem CID 942205) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is (4,6-dimethylpyrimidin-2-yl)-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]cyanamide.
| Compound Name | (4,6-dimethylpyrimidin-2-yl)-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]cyanamide |
|---|---|
| PubChem CID | 942205 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (4,6-dimethylpyrimidin-2-yl)-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]cyanamide |
| SMILES | Cc1cc(C)nc(N(C#N)CC(=O)c2c(C)[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C18H17N5O/c1-11-8-12(2)21-18(20-11)23(10-19)9-16(24)17-13(3)22-15-7-5-4-6-14(15)17/h4-8,22H,9H2,1-3H3 |
| InChIKey | GRWLWDBIOUDNAJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|