C22H31N3O3S — CID 9422564
methyl 6-[[4-[4-(2,2-dimethylpropanoylamino)phenyl]-5-methyl-1,3-thiazol-2-yl]amino]hexanoate (PubChem CID 9422564) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is methyl 6-[[4-[4-(2,2-dimethylpropanoylamino)phenyl]-5-methyl-1,3-thiazol-2-yl]amino]hexanoate.
| Compound Name | methyl 6-[[4-[4-(2,2-dimethylpropanoylamino)phenyl]-5-methyl-1,3-thiazol-2-yl]amino]hexanoate |
|---|---|
| PubChem CID | 9422564 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | methyl 6-[[4-[4-(2,2-dimethylpropanoylamino)phenyl]-5-methyl-1,3-thiazol-2-yl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNc1nc(-c2ccc(NC(=O)C(C)(C)C)cc2)c(C)s1 |
| InChI | InChI=1S/C22H31N3O3S/c1-15-19(16-10-12-17(13-11-16)24-20(27)22(2,3)4)25-21(29-15)23-14-8-6-7-9-18(26)28-5/h10-13H,6-9,14H2,1-5H3,(H,23,25)(H,24,27) |
| InChIKey | DTJXUDLFKZMJMY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|