C20H20N6 — CID 942625
7-methyl-4-(4-pyridin-2-ylpiperazin-1-yl)-5H-pyrimido[5,4-b]indole (PubChem CID 942625) has the molecular formula C20H20N6 and a molecular weight of 344.42 g/mol. Its IUPAC name is 7-methyl-4-(4-pyridin-2-ylpiperazin-1-yl)-5H-pyrimido[5,4-b]indole.
| Compound Name | 7-methyl-4-(4-pyridin-2-ylpiperazin-1-yl)-5H-pyrimido[5,4-b]indole |
|---|---|
| PubChem CID | 942625 |
| Molecular Formula | C20H20N6 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 7-methyl-4-(4-pyridin-2-ylpiperazin-1-yl)-5H-pyrimido[5,4-b]indole |
| SMILES | Cc1ccc2c(c1)[nH]c1c(N3CCN(c4ccccn4)CC3)ncnc12 |
| InChI | InChI=1S/C20H20N6/c1-14-5-6-15-16(12-14)24-19-18(15)22-13-23-20(19)26-10-8-25(9-11-26)17-4-2-3-7-21-17/h2-7,12-13,24H,8-11H2,1H3 |
| InChIKey | AFKHDQOHBHJHHV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |