C15H19NO2 — CID 94266199
2-[4-(2-methylpropyl)phenyl]-2-oxo-N-prop-2-enylacetamide (PubChem CID 94266199) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-[4-(2-methylpropyl)phenyl]-2-oxo-N-prop-2-enylacetamide.
| Compound Name | 2-[4-(2-methylpropyl)phenyl]-2-oxo-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 94266199 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-[4-(2-methylpropyl)phenyl]-2-oxo-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)C(=O)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C15H19NO2/c1-4-9-16-15(18)14(17)13-7-5-12(6-8-13)10-11(2)3/h4-8,11H,1,9-10H2,2-3H3,(H,16,18) |
| InChIKey | AOJDJZSAANXGHZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|