C15H20S — CID 143670977
1-(2-methylpropyl)-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]benzene (PubChem CID 143670977) has the molecular formula C15H20S and a molecular weight of 232.39 g/mol. Its IUPAC name is 1-(2-methylpropyl)-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]benzene.
| Compound Name | 1-(2-methylpropyl)-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 143670977 |
| Molecular Formula | C15H20S |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1-(2-methylpropyl)-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]benzene |
| SMILES | C=C/C=C(\SC)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C15H20S/c1-5-6-15(16-4)14-9-7-13(8-10-14)11-12(2)3/h5-10,12H,1,11H2,2-4H3/b15-6- |
| InChIKey | ZZGKKOZGOJMIIQ-UUASQNMZSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|