C15H20N4 — CID 94271829
N-[5-(3-aminophenyl)-2-pyridinyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 94271829) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is N-[5-(3-aminophenyl)-2-pyridinyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[5-(3-aminophenyl)-2-pyridinyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 94271829 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | N-[5-(3-aminophenyl)-2-pyridinyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNc1ccc(-c2cccc(N)c2)cn1 |
| InChI | InChI=1S/C15H20N4/c1-19(2)9-8-17-15-7-6-13(11-18-15)12-4-3-5-14(16)10-12/h3-7,10-11H,8-9,16H2,1-2H3,(H,17,18) |
| InChIKey | XJYUBNKPDFWREU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|