C15H20N2O3 — CID 94285171
1-(4-ethylpiperazin-1-yl)-2-(2-methoxyphenyl)ethane-1,2-dione (PubChem CID 94285171) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-(4-ethylpiperazin-1-yl)-2-(2-methoxyphenyl)ethane-1,2-dione.
| Compound Name | 1-(4-ethylpiperazin-1-yl)-2-(2-methoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 94285171 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 1-(4-ethylpiperazin-1-yl)-2-(2-methoxyphenyl)ethane-1,2-dione |
| SMILES | CCN1CCN(C(=O)C(=O)c2ccccc2OC)CC1 |
| InChI | InChI=1S/C15H20N2O3/c1-3-16-8-10-17(11-9-16)15(19)14(18)12-6-4-5-7-13(12)20-2/h4-7H,3,8-11H2,1-2H3 |
| InChIKey | GVHSTBNYXHPESV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|