C20H19N3O6 — CID 9428730
N-methyl-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[(4-prop-2-enoxyphenyl)methyl]acetamide (PubChem CID 9428730) has the molecular formula C20H19N3O6 and a molecular weight of 397.39 g/mol. Its IUPAC name is N-methyl-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[(4-prop-2-enoxyphenyl)methyl]acetamide.
| Compound Name | N-methyl-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[(4-prop-2-enoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 9428730 |
| Molecular Formula | C20H19N3O6 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | N-methyl-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[(4-prop-2-enoxyphenyl)methyl]acetamide |
| SMILES | C=CCOc1ccc(CN(C)C(=O)Cn2c(=O)oc3cc([N+](=O)[O-])ccc32)cc1 |
| InChI | InChI=1S/C20H19N3O6/c1-3-10-28-16-7-4-14(5-8-16)12-21(2)19(24)13-22-17-9-6-15(23(26)27)11-18(17)29-20(22)25/h3-9,11H,1,10,12-13H2,2H3 |
| InChIKey | WLVJKEPUGHNJFK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 107.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|