C21H29FN4O — CID 9431281
(2S)-N-(1-cyanocyclohexyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]-N-methylpropanamide (PubChem CID 9431281) has the molecular formula C21H29FN4O and a molecular weight of 372.49 g/mol. Its IUPAC name is (2S)-N-(1-cyanocyclohexyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]-N-methylpropanamide.
| Compound Name | (2S)-N-(1-cyanocyclohexyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 9431281 |
| Molecular Formula | C21H29FN4O |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (2S)-N-(1-cyanocyclohexyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]-N-methylpropanamide |
| SMILES | C[C@@H](C(=O)N(C)C1(C#N)CCCCC1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H29FN4O/c1-17(20(27)24(2)21(16-23)10-4-3-5-11-21)25-12-14-26(15-13-25)19-8-6-18(22)7-9-19/h6-9,17H,3-5,10-15H2,1-2H3/t17-/m0/s1 |
| InChIKey | KBMXOTLXSIFTMA-KRWDZBQOSA-N |
| XLogP | 3.02 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |