C21H31N4O+ — CID 9250117
(2S)-N-(1-cyanocyclohexyl)-N-methyl-2-(4-phenylpiperazin-1-ium-1-yl)propanamide (PubChem CID 9250117) has the molecular formula C21H31N4O+ and a molecular weight of 355.51 g/mol. Its IUPAC name is (2S)-N-(1-cyanocyclohexyl)-N-methyl-2-(4-phenylpiperazin-1-ium-1-yl)propanamide.
| Compound Name | (2S)-N-(1-cyanocyclohexyl)-N-methyl-2-(4-phenylpiperazin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 9250117 |
| Molecular Formula | C21H31N4O+ |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | (2S)-N-(1-cyanocyclohexyl)-N-methyl-2-(4-phenylpiperazin-1-ium-1-yl)propanamide |
| SMILES | C[C@@H](C(=O)N(C)C1(C#N)CCCCC1)[NH+]1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H30N4O/c1-18(20(26)23(2)21(17-22)11-7-4-8-12-21)24-13-15-25(16-14-24)19-9-5-3-6-10-19/h3,5-6,9-10,18H,4,7-8,11-16H2,1-2H3/p+1/t18-/m0/s1 |
| InChIKey | PUWIHAOZAUDICS-SFHVURJKSA-O |
| XLogP | 1.46 |
| TPSA | 51.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |