C21H30ClN4O+ — CID 9444854
(2S)-2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(1-cyanocyclohexyl)-N-methylpropanamide (PubChem CID 9444854) has the molecular formula C21H30ClN4O+ and a molecular weight of 389.95 g/mol. Its IUPAC name is (2S)-2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(1-cyanocyclohexyl)-N-methylpropanamide.
| Compound Name | (2S)-2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(1-cyanocyclohexyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 9444854 |
| Molecular Formula | C21H30ClN4O+ |
| Molecular Weight | 389.95 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | (2S)-2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(1-cyanocyclohexyl)-N-methylpropanamide |
| SMILES | C[C@@H](C(=O)N(C)C1(C#N)CCCCC1)[NH+]1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H29ClN4O/c1-17(20(27)24(2)21(16-23)10-6-3-7-11-21)25-12-14-26(15-13-25)19-9-5-4-8-18(19)22/h4-5,8-9,17H,3,6-7,10-15H2,1-2H3/p+1/t17-/m0/s1 |
| InChIKey | FNRWQFKQJMDSOZ-KRWDZBQOSA-O |
| XLogP | 2.12 |
| TPSA | 51.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.95 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |