C15H16ClFN2OS — CID 9434187
N-(5-chloro-2-fluorophenyl)-2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]acetamide (PubChem CID 9434187) has the molecular formula C15H16ClFN2OS and a molecular weight of 326.82 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]acetamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 9434187 |
| Molecular Formula | C15H16ClFN2OS |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]acetamide |
| SMILES | Cc1ccsc1CN(C)CC(=O)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C15H16ClFN2OS/c1-10-5-6-21-14(10)8-19(2)9-15(20)18-13-7-11(16)3-4-12(13)17/h3-7H,8-9H2,1-2H3,(H,18,20) |
| InChIKey | AWWNEHHOBSZBSM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |