C14H14ClFN2OS — CID 9054913
N-(5-chloro-2-fluorophenyl)-2-[methyl(thiophen-3-ylmethyl)amino]acetamide (PubChem CID 9054913) has the molecular formula C14H14ClFN2OS and a molecular weight of 312.80 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-2-[methyl(thiophen-3-ylmethyl)amino]acetamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-2-[methyl(thiophen-3-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 9054913 |
| Molecular Formula | C14H14ClFN2OS |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-2-[methyl(thiophen-3-ylmethyl)amino]acetamide |
| SMILES | CN(CC(=O)Nc1cc(Cl)ccc1F)Cc1ccsc1 |
| InChI | InChI=1S/C14H14ClFN2OS/c1-18(7-10-4-5-20-9-10)8-14(19)17-13-6-11(15)2-3-12(13)16/h2-6,9H,7-8H2,1H3,(H,17,19) |
| InChIKey | DTSWKOHTHRFZKF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |