C17H19NO3S — CID 94342118
(2R)-2-[2-(4-methoxyphenoxy)ethylsulfanyl]-2-phenylacetamide (PubChem CID 94342118) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is (2R)-2-[2-(4-methoxyphenoxy)ethylsulfanyl]-2-phenylacetamide.
| Compound Name | (2R)-2-[2-(4-methoxyphenoxy)ethylsulfanyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 94342118 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | (2R)-2-[2-(4-methoxyphenoxy)ethylsulfanyl]-2-phenylacetamide |
| SMILES | COc1ccc(OCCS[C@@H](C(N)=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H19NO3S/c1-20-14-7-9-15(10-8-14)21-11-12-22-16(17(18)19)13-5-3-2-4-6-13/h2-10,16H,11-12H2,1H3,(H2,18,19)/t16-/m1/s1 |
| InChIKey | IUXYPICQAIRJCL-MRXNPFEDSA-N |
| XLogP | 3.03 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|