C14H14F2N2O3 — CID 94385721
(7aS)-2-[(2R)-2-(2,5-difluorophenyl)-2-hydroxyethyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 94385721) has the molecular formula C14H14F2N2O3 and a molecular weight of 296.27 g/mol. Its IUPAC name is (7aS)-2-[(2R)-2-(2,5-difluorophenyl)-2-hydroxyethyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | (7aS)-2-[(2R)-2-(2,5-difluorophenyl)-2-hydroxyethyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 94385721 |
| Molecular Formula | C14H14F2N2O3 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (7aS)-2-[(2R)-2-(2,5-difluorophenyl)-2-hydroxyethyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | O=C1[C@@H]2CCCN2C(=O)N1C[C@H](O)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H14F2N2O3/c15-8-3-4-10(16)9(6-8)12(19)7-18-13(20)11-2-1-5-17(11)14(18)21/h3-4,6,11-12,19H,1-2,5,7H2/t11-,12-/m0/s1 |
| InChIKey | JQJYHKBPFGHGPE-RYUDHWBXSA-N |
| XLogP | 1.42 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|