C20H24N4 — CID 94393048
(2R)-2-[[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]methyl]pentanedinitrile (PubChem CID 94393048) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is (2R)-2-[[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]methyl]pentanedinitrile.
| Compound Name | (2R)-2-[[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]methyl]pentanedinitrile |
|---|---|
| PubChem CID | 94393048 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (2R)-2-[[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]methyl]pentanedinitrile |
| SMILES | Cc1[nH]c2ccccc2c1C1CCN(C[C@H](C#N)CCC#N)CC1 |
| InChI | InChI=1S/C20H24N4/c1-15-20(18-6-2-3-7-19(18)23-15)17-8-11-24(12-9-17)14-16(13-22)5-4-10-21/h2-3,6-7,16-17,23H,4-5,8-9,11-12,14H2,1H3/t16-/m0/s1 |
| InChIKey | JHAYMKZIEYXLID-INIZCTEOSA-N |
| XLogP | 4.10 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|