C17H22N4O2S — CID 94615297
N-[1-[(2R)-2,4-dicyanobutyl]piperidin-4-yl]benzenesulfonamide (PubChem CID 94615297) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[1-[(2R)-2,4-dicyanobutyl]piperidin-4-yl]benzenesulfonamide.
| Compound Name | N-[1-[(2R)-2,4-dicyanobutyl]piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 94615297 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[1-[(2R)-2,4-dicyanobutyl]piperidin-4-yl]benzenesulfonamide |
| SMILES | N#CCC[C@@H](C#N)CN1CCC(NS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H22N4O2S/c18-10-4-5-15(13-19)14-21-11-8-16(9-12-21)20-24(22,23)17-6-2-1-3-7-17/h1-3,6-7,15-16,20H,4-5,8-9,11-12,14H2/t15-/m0/s1 |
| InChIKey | MZRKPSCNCYRRBL-HNNXBMFYSA-N |
| XLogP | 1.87 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |