C16H16F3N3O4S — CID 9439467
1-(2-methoxyphenyl)-3-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]urea (PubChem CID 9439467) has the molecular formula C16H16F3N3O4S and a molecular weight of 403.38 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]urea.
| Compound Name | 1-(2-methoxyphenyl)-3-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]urea |
|---|---|
| PubChem CID | 9439467 |
| Molecular Formula | C16H16F3N3O4S |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]urea |
| SMILES | COc1ccccc1NC(=O)Nc1ccc(S(=O)(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16F3N3O4S/c1-26-14-5-3-2-4-13(14)22-15(23)21-11-6-8-12(9-7-11)27(24,25)20-10-16(17,18)19/h2-9,20H,10H2,1H3,(H2,21,22,23) |
| InChIKey | JAFJJWBOTZCNHZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |