C14H22N3O2S+ — CID 9444116
2-[[(2R)-2-(4-methylpiperidin-1-ium-1-yl)propanoyl]amino]thiophene-3-carboxamide (PubChem CID 9444116) has the molecular formula C14H22N3O2S+ and a molecular weight of 296.42 g/mol. Its IUPAC name is 2-[[(2R)-2-(4-methylpiperidin-1-ium-1-yl)propanoyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[(2R)-2-(4-methylpiperidin-1-ium-1-yl)propanoyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 9444116 |
| Molecular Formula | C14H22N3O2S+ |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-[[(2R)-2-(4-methylpiperidin-1-ium-1-yl)propanoyl]amino]thiophene-3-carboxamide |
| SMILES | CC1CC[NH+]([C@H](C)C(=O)Nc2sccc2C(N)=O)CC1 |
| InChI | InChI=1S/C14H21N3O2S/c1-9-3-6-17(7-4-9)10(2)13(19)16-14-11(12(15)18)5-8-20-14/h5,8-10H,3-4,6-7H2,1-2H3,(H2,15,18)(H,16,19)/p+1/t10-/m1/s1 |
| InChIKey | AJFYKBKCUWLYLB-SNVBAGLBSA-O |
| XLogP | 0.49 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |